About N-cyclohexyl-N-cyclopropyl-4-methoxybenzamide;methyl acetate
N-cyclohexyl-N-cyclopropyl-4-methoxybenzamide;methyl acetate (PubChem CID 143724469) has the molecular formula C20H29NO4
and a molecular weight of 347.46 g/mol. Its IUPAC name is N-cyclohexyl-N-cyclopropyl-4-methoxybenzamide;methyl acetate.
Molecular Properties
| Compound Name | N-cyclohexyl-N-cyclopropyl-4-methoxybenzamide;methyl acetate |
| PubChem CID | 143724469 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | N-cyclohexyl-N-cyclopropyl-4-methoxybenzamide;methyl acetate |
| SMILES | COC(C)=O.COc1ccc(C(=O)N(C2CCCCC2)C2CC2)cc1 |
| InChI | InChI=1S/C17H23NO2.C3H6O2/c1-20-16-11-7-13(8-12-16)17(19)18(15-9-10-15)14-5-3-2-4-6-14;1-3(4)5-2/h7-8,11-12,14-15H,2-6,9-10H2,1H3;1-2H3 |
| InChIKey | UDSDPNTXOPWROP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclohexyl-N-cyclopropyl-4-methoxybenzamide;methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N-cyclopropyl-4-methoxybenzamide;methyl acetate?
The IUPAC name of N-cyclohexyl-N-cyclopropyl-4-methoxybenzamide;methyl acetate (CID 143724469) is N-cyclohexyl-N-cyclopropyl-4-methoxybenzamide;methyl acetate.
What is the SMILES notation for N-cyclohexyl-N-cyclopropyl-4-methoxybenzamide;methyl acetate?
The canonical SMILES for N-cyclohexyl-N-cyclopropyl-4-methoxybenzamide;methyl acetate is COC(C)=O.COc1ccc(C(=O)N(C2CCCCC2)C2CC2)cc1.
What is the InChIKey of N-cyclohexyl-N-cyclopropyl-4-methoxybenzamide;methyl acetate?
The InChIKey is UDSDPNTXOPWROP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO2.C3H6O2/c1-20-16-11-7-13(8-12-16)17(19)18(15-9-10-15)14-5-3-2-4-6-14;1-3(4)5-2/h7-8,11-12,14-15H,2-6,9-10H2,1H3;1-2H3.
What are the key properties of N-cyclohexyl-N-cyclopropyl-4-methoxybenzamide;methyl acetate?
N-cyclohexyl-N-cyclopropyl-4-methoxybenzamide;methyl acetate has a molecular weight of 347.46 g/mol, XLogP of 3.81, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N-cyclopropyl-4-methoxybenzamide;methyl acetate is sourced from PubChem (CID 143724469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).