C19H26FNO — CID 784952
N,N-dicyclohexyl-4-fluorobenzamide (PubChem CID 784952) has the molecular formula C19H26FNO and a molecular weight of 303.42 g/mol. Its IUPAC name is N,N-dicyclohexyl-4-fluorobenzamide.
| Compound Name | N,N-dicyclohexyl-4-fluorobenzamide |
|---|---|
| PubChem CID | 784952 |
| Molecular Formula | C19H26FNO |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | N,N-dicyclohexyl-4-fluorobenzamide |
| SMILES | O=C(c1ccc(F)cc1)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C19H26FNO/c20-16-13-11-15(12-14-16)19(22)21(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h11-14,17-18H,1-10H2 |
| InChIKey | MWOCFHUVFRXFNF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |