C23H24FN3O5S — CID 25039846
N-cyclohexyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-4-fluorobenzamide (PubChem CID 25039846) has the molecular formula C23H24FN3O5S and a molecular weight of 473.53 g/mol. Its IUPAC name is N-cyclohexyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-4-fluorobenzamide.
| Compound Name | N-cyclohexyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 25039846 |
| Molecular Formula | C23H24FN3O5S |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-cyclohexyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-4-fluorobenzamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(N(C(=O)c3ccc(F)cc3)C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C23H24FN3O5S/c24-16-8-6-15(7-9-16)22(29)26(17-4-2-1-3-5-17)20-14-21(28)27(23(20)30)18-10-12-19(13-11-18)33(25,31)32/h6-13,17,20H,1-5,14H2,(H2,25,31,32) |
| InChIKey | PDCAFIGPZWKKPW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|