C21H23N3O5S2 — CID 25036355
N-cyclohexyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-carboxamide (PubChem CID 25036355) has the molecular formula C21H23N3O5S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is N-cyclohexyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | N-cyclohexyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 25036355 |
| Molecular Formula | C21H23N3O5S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | N-cyclohexyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(N(C(=O)c3cccs3)C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C21H23N3O5S2/c22-31(28,29)16-10-8-15(9-11-16)24-19(25)13-17(20(24)26)23(14-5-2-1-3-6-14)21(27)18-7-4-12-30-18/h4,7-12,14,17H,1-3,5-6,13H2,(H2,22,28,29) |
| InChIKey | ALDBSXKSKJCPFP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|