C23H24N2O5S — CID 23971114
[4-[3-[cyclohexyl(thiophene-2-carbonyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate (PubChem CID 23971114) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is [4-[3-[cyclohexyl(thiophene-2-carbonyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate.
| Compound Name | [4-[3-[cyclohexyl(thiophene-2-carbonyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
|---|---|
| PubChem CID | 23971114 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | [4-[3-[cyclohexyl(thiophene-2-carbonyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)CC(N(C(=O)c3cccs3)C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C23H24N2O5S/c1-15(26)30-18-11-9-17(10-12-18)25-21(27)14-19(22(25)28)24(16-6-3-2-4-7-16)23(29)20-8-5-13-31-20/h5,8-13,16,19H,2-4,6-7,14H2,1H3 |
| InChIKey | UXHGDJZZGATNMO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|