C20H22N2O4S — CID 23859411
N-tert-butyl-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-carboxamide (PubChem CID 23859411) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is N-tert-butyl-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | N-tert-butyl-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 23859411 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-tert-butyl-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-carboxamide |
| SMILES | COc1ccc(N2C(=O)CC(N(C(=O)c3cccs3)C(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C20H22N2O4S/c1-20(2,3)22(19(25)16-6-5-11-27-16)15-12-17(23)21(18(15)24)13-7-9-14(26-4)10-8-13/h5-11,15H,12H2,1-4H3 |
| InChIKey | WKDPZHZLWVBABP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|