C24H21N3O5S — CID 3296136
N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-thiophen-2-ylacetyl)benzohydrazide (PubChem CID 3296136) has the molecular formula C24H21N3O5S and a molecular weight of 463.52 g/mol. Its IUPAC name is N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-thiophen-2-ylacetyl)benzohydrazide.
| Compound Name | N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-thiophen-2-ylacetyl)benzohydrazide |
|---|---|
| PubChem CID | 3296136 |
| Molecular Formula | C24H21N3O5S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-thiophen-2-ylacetyl)benzohydrazide |
| SMILES | COc1ccc(N2C(=O)CC(N(NC(=O)Cc3cccs3)C(=O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C24H21N3O5S/c1-32-18-11-9-17(10-12-18)26-22(29)15-20(24(26)31)27(23(30)16-6-3-2-4-7-16)25-21(28)14-19-8-5-13-33-19/h2-13,20H,14-15H2,1H3,(H,25,28) |
| InChIKey | HWUHQLHIHXKGJV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|