C23H18N4O6S — CID 5033463
N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-4-nitro-N'-(2-thiophen-2-ylacetyl)benzohydrazide (PubChem CID 5033463) has the molecular formula C23H18N4O6S and a molecular weight of 478.49 g/mol. Its IUPAC name is N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-4-nitro-N'-(2-thiophen-2-ylacetyl)benzohydrazide.
| Compound Name | N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-4-nitro-N'-(2-thiophen-2-ylacetyl)benzohydrazide |
|---|---|
| PubChem CID | 5033463 |
| Molecular Formula | C23H18N4O6S |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-4-nitro-N'-(2-thiophen-2-ylacetyl)benzohydrazide |
| SMILES | O=C(Cc1cccs1)NN(C(=O)c1ccc([N+](=O)[O-])cc1)C1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C23H18N4O6S/c28-20(13-18-7-4-12-34-18)24-26(22(30)15-8-10-17(11-9-15)27(32)33)19-14-21(29)25(23(19)31)16-5-2-1-3-6-16/h1-12,19H,13-14H2,(H,24,28) |
| InChIKey | OCDBWJXVAXZVHU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|