C23H18ClN3O4S — CID 5042843
2-chloro-N'-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N'-(2-thiophen-2-ylacetyl)benzohydrazide (PubChem CID 5042843) has the molecular formula C23H18ClN3O4S and a molecular weight of 467.93 g/mol. Its IUPAC name is 2-chloro-N'-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N'-(2-thiophen-2-ylacetyl)benzohydrazide.
| Compound Name | 2-chloro-N'-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N'-(2-thiophen-2-ylacetyl)benzohydrazide |
|---|---|
| PubChem CID | 5042843 |
| Molecular Formula | C23H18ClN3O4S |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 2-chloro-N'-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N'-(2-thiophen-2-ylacetyl)benzohydrazide |
| SMILES | O=C(NN(C(=O)Cc1cccs1)C1CC(=O)N(c2ccccc2)C1=O)c1ccccc1Cl |
| InChI | InChI=1S/C23H18ClN3O4S/c24-18-11-5-4-10-17(18)22(30)25-27(21(29)13-16-9-6-12-32-16)19-14-20(28)26(23(19)31)15-7-2-1-3-8-15/h1-12,19H,13-14H2,(H,25,30) |
| InChIKey | LBILVAXFOMTKNC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|