C25H20ClN3O4 — CID 4669770
3-chloro-N'-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N'-(2-phenylacetyl)benzohydrazide (PubChem CID 4669770) has the molecular formula C25H20ClN3O4 and a molecular weight of 461.91 g/mol. Its IUPAC name is 3-chloro-N'-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N'-(2-phenylacetyl)benzohydrazide.
| Compound Name | 3-chloro-N'-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N'-(2-phenylacetyl)benzohydrazide |
|---|---|
| PubChem CID | 4669770 |
| Molecular Formula | C25H20ClN3O4 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 3-chloro-N'-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N'-(2-phenylacetyl)benzohydrazide |
| SMILES | O=C(NN(C(=O)Cc1ccccc1)C1CC(=O)N(c2ccccc2)C1=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H20ClN3O4/c26-19-11-7-10-18(15-19)24(32)27-29(23(31)14-17-8-3-1-4-9-17)21-16-22(30)28(25(21)33)20-12-5-2-6-13-20/h1-13,15,21H,14,16H2,(H,27,32) |
| InChIKey | PYJOQIVYMIGMMF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|