C20H19ClN2O3 — CID 1364939
N-[(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)acetamide (PubChem CID 1364939) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is N-[(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)acetamide.
| Compound Name | N-[(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 1364939 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)acetamide |
| SMILES | CC(=O)N(CCc1ccccc1)[C@@H]1CC(=O)N(c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C20H19ClN2O3/c1-14(24)22(11-10-15-6-3-2-4-7-15)18-13-19(25)23(20(18)26)17-9-5-8-16(21)12-17/h2-9,12,18H,10-11,13H2,1H3/t18-/m1/s1 |
| InChIKey | LXTYRGGUXKAVII-GOSISDBHSA-N |
| XLogP | 3.06 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|