C23H27ClN2O3 — CID 7288980
N-(1-adamantylmethyl)-N-[(3S)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]acetamide (PubChem CID 7288980) has the molecular formula C23H27ClN2O3 and a molecular weight of 414.93 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-N-[(3S)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]acetamide.
| Compound Name | N-(1-adamantylmethyl)-N-[(3S)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 7288980 |
| Molecular Formula | C23H27ClN2O3 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-(1-adamantylmethyl)-N-[(3S)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]acetamide |
| SMILES | CC(=O)N(CC12CC3CC(CC(C3)C1)C2)[C@H]1CC(=O)N(c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C23H27ClN2O3/c1-14(27)25(13-23-10-15-5-16(11-23)7-17(6-15)12-23)20-9-21(28)26(22(20)29)19-4-2-3-18(24)8-19/h2-4,8,15-17,20H,5-7,9-13H2,1H3/t15?,16?,17?,20-,23?/m0/s1 |
| InChIKey | OZYLXGUWIMYHKZ-SXYIGIQMSA-N |
| XLogP | 4.04 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|