C24H30ClN3O2 — CID 7106893
(3R)-3-[4-(1-adamantyl)piperazin-1-yl]-1-(3-chlorophenyl)pyrrolidine-2,5-dione (PubChem CID 7106893) has the molecular formula C24H30ClN3O2 and a molecular weight of 427.98 g/mol. Its IUPAC name is (3R)-3-[4-(1-adamantyl)piperazin-1-yl]-1-(3-chlorophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(1-adamantyl)piperazin-1-yl]-1-(3-chlorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7106893 |
| Molecular Formula | C24H30ClN3O2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | (3R)-3-[4-(1-adamantyl)piperazin-1-yl]-1-(3-chlorophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](N2CCN(C34CC5CC(CC(C5)C3)C4)CC2)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H30ClN3O2/c25-19-2-1-3-20(11-19)28-22(29)12-21(23(28)30)26-4-6-27(7-5-26)24-13-16-8-17(14-24)10-18(9-16)15-24/h1-3,11,16-18,21H,4-10,12-15H2/t16?,17?,18?,21-,24?/m1/s1 |
| InChIKey | DBEPJJYQQWIPPP-WWKNUYBVSA-N |
| XLogP | 3.56 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|