C20H19Cl2N3O2 — CID 1087586
(3R)-1-(3-chlorophenyl)-3-[4-(4-chlorophenyl)piperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 1087586) has the molecular formula C20H19Cl2N3O2 and a molecular weight of 404.30 g/mol. Its IUPAC name is (3R)-1-(3-chlorophenyl)-3-[4-(4-chlorophenyl)piperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(3-chlorophenyl)-3-[4-(4-chlorophenyl)piperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1087586 |
| Molecular Formula | C20H19Cl2N3O2 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | (3R)-1-(3-chlorophenyl)-3-[4-(4-chlorophenyl)piperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](N2CCN(c3ccc(Cl)cc3)CC2)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H19Cl2N3O2/c21-14-4-6-16(7-5-14)23-8-10-24(11-9-23)18-13-19(26)25(20(18)27)17-3-1-2-15(22)12-17/h1-7,12,18H,8-11,13H2/t18-/m1/s1 |
| InChIKey | BJSHDMJDRPNHIB-GOSISDBHSA-N |
| XLogP | 3.45 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|