C27H23ClFN3O3 — CID 27150944
(3R)-1-(3-chlorophenyl)-3-[4-[4-(4-fluorobenzoyl)phenyl]piperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 27150944) has the molecular formula C27H23ClFN3O3 and a molecular weight of 491.95 g/mol. Its IUPAC name is (3R)-1-(3-chlorophenyl)-3-[4-[4-(4-fluorobenzoyl)phenyl]piperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(3-chlorophenyl)-3-[4-[4-(4-fluorobenzoyl)phenyl]piperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 27150944 |
| Molecular Formula | C27H23ClFN3O3 |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | (3R)-1-(3-chlorophenyl)-3-[4-[4-(4-fluorobenzoyl)phenyl]piperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C(c1ccc(F)cc1)c1ccc(N2CCN([C@@H]3CC(=O)N(c4cccc(Cl)c4)C3=O)CC2)cc1 |
| InChI | InChI=1S/C27H23ClFN3O3/c28-20-2-1-3-23(16-20)32-25(33)17-24(27(32)35)31-14-12-30(13-15-31)22-10-6-19(7-11-22)26(34)18-4-8-21(29)9-5-18/h1-11,16,24H,12-15,17H2/t24-/m1/s1 |
| InChIKey | HWBDWCYOGRUQTM-XMMPIXPASA-N |
| XLogP | 4.16 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|