C24H22Cl2N4O4 — CID 3091910
1-(3-chlorophenyl)-3-[4-[1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 3091910) has the molecular formula C24H22Cl2N4O4 and a molecular weight of 501.37 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[4-[1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-(3-chlorophenyl)-3-[4-[1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 3091910 |
| Molecular Formula | C24H22Cl2N4O4 |
| Molecular Weight | 501.37 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[4-[1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(N2CCN(C3CC(=O)N(c4cccc(Cl)c4)C3=O)CC2)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H22Cl2N4O4/c25-15-3-1-5-17(11-15)29-21(31)13-19(23(29)33)27-7-9-28(10-8-27)20-14-22(32)30(24(20)34)18-6-2-4-16(26)12-18/h1-6,11-12,19-20H,7-10,13-14H2 |
| InChIKey | UNKUQGPJSAFXHQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|