C12H10ClNO4S — CID 776640
2-[(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetic acid (PubChem CID 776640) has the molecular formula C12H10ClNO4S and a molecular weight of 299.74 g/mol. Its IUPAC name is 2-[(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetic acid.
| Compound Name | 2-[(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 776640 |
| Molecular Formula | C12H10ClNO4S |
| Molecular Weight | 299.74 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 2-[(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetic acid |
| SMILES | O=C(O)CS[C@@H]1CC(=O)N(c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C12H10ClNO4S/c13-7-2-1-3-8(4-7)14-10(15)5-9(12(14)18)19-6-11(16)17/h1-4,9H,5-6H2,(H,16,17)/t9-/m1/s1 |
| InChIKey | SFHCMXCGDCGBOJ-SECBINFHSA-N |
| XLogP | 1.79 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.74 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|