C23H18ClN3O3S — CID 19059067
1-[4-[1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylurea (PubChem CID 19059067) has the molecular formula C23H18ClN3O3S and a molecular weight of 451.94 g/mol. Its IUPAC name is 1-[4-[1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylurea.
| Compound Name | 1-[4-[1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylurea |
|---|---|
| PubChem CID | 19059067 |
| Molecular Formula | C23H18ClN3O3S |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 1-[4-[1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(SC2CC(=O)N(c3cccc(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C23H18ClN3O3S/c24-15-5-4-8-18(13-15)27-21(28)14-20(22(27)29)31-19-11-9-17(10-12-19)26-23(30)25-16-6-2-1-3-7-16/h1-13,20H,14H2,(H2,25,26,30) |
| InChIKey | VOGUFOASISIQAH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|