C23H17Cl2N3O2S2 — CID 99128949
1-[4-[(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylthiourea (PubChem CID 99128949) has the molecular formula C23H17Cl2N3O2S2 and a molecular weight of 502.45 g/mol. Its IUPAC name is 1-[4-[(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylthiourea.
| Compound Name | 1-[4-[(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 99128949 |
| Molecular Formula | C23H17Cl2N3O2S2 |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 501.01 |
| IUPAC Name | 1-[4-[(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylthiourea |
| SMILES | O=C1C[C@@H](Sc2ccc(NC(=S)Nc3ccccc3)cc2)C(=O)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H17Cl2N3O2S2/c24-18-11-8-16(12-19(18)25)28-21(29)13-20(22(28)30)32-17-9-6-15(7-10-17)27-23(31)26-14-4-2-1-3-5-14/h1-12,20H,13H2,(H2,26,27,31)/t20-/m1/s1 |
| InChIKey | GRKGGFXUKXRJRQ-HXUWFJFHSA-N |
| XLogP | 6.23 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|