C20H17ClN2O3S — CID 99129839
N-[4-[(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]cyclopropanecarboxamide (PubChem CID 99129839) has the molecular formula C20H17ClN2O3S and a molecular weight of 400.89 g/mol. Its IUPAC name is N-[4-[(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 99129839 |
| Molecular Formula | C20H17ClN2O3S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | N-[4-[(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1ccc(S[C@@H]2CC(=O)N(c3cccc(Cl)c3)C2=O)cc1)C1CC1 |
| InChI | InChI=1S/C20H17ClN2O3S/c21-13-2-1-3-15(10-13)23-18(24)11-17(20(23)26)27-16-8-6-14(7-9-16)22-19(25)12-4-5-12/h1-3,6-10,12,17H,4-5,11H2,(H,22,25)/t17-/m1/s1 |
| InChIKey | QIXUHBJYVJPLDS-QGZVFWFLSA-N |
| XLogP | 4.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|