C25H26N2O4S — CID 22782564
N-[4-[1-(4-acetylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]cyclohexanecarboxamide (PubChem CID 22782564) has the molecular formula C25H26N2O4S and a molecular weight of 450.56 g/mol. Its IUPAC name is N-[4-[1-(4-acetylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-[1-(4-acetylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 22782564 |
| Molecular Formula | C25H26N2O4S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | N-[4-[1-(4-acetylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]cyclohexanecarboxamide |
| SMILES | CC(=O)c1ccc(N2C(=O)CC(Sc3ccc(NC(=O)C4CCCCC4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H26N2O4S/c1-16(28)17-7-11-20(12-8-17)27-23(29)15-22(25(27)31)32-21-13-9-19(10-14-21)26-24(30)18-5-3-2-4-6-18/h7-14,18,22H,2-6,15H2,1H3,(H,26,30) |
| InChIKey | QIHIMTMUMFRUJA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|