C27H26N2O3S — CID 23095222
N-[4-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]sulfanylphenyl]-4-methylbenzamide (PubChem CID 23095222) has the molecular formula C27H26N2O3S and a molecular weight of 458.58 g/mol. Its IUPAC name is N-[4-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]sulfanylphenyl]-4-methylbenzamide.
| Compound Name | N-[4-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]sulfanylphenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 23095222 |
| Molecular Formula | C27H26N2O3S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | N-[4-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]sulfanylphenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(SC3CC(=O)N(c4ccc(C(C)C)cc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C27H26N2O3S/c1-17(2)19-8-12-22(13-9-19)29-25(30)16-24(27(29)32)33-23-14-10-21(11-15-23)28-26(31)20-6-4-18(3)5-7-20/h4-15,17,24H,16H2,1-3H3,(H,28,31) |
| InChIKey | ARZORLYIBNSWDK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|