C17H14ClNO2S — CID 1487266
(3S)-1-(4-chlorophenyl)-3-(4-methylphenyl)sulfanylpyrrolidine-2,5-dione (PubChem CID 1487266) has the molecular formula C17H14ClNO2S and a molecular weight of 331.82 g/mol. Its IUPAC name is (3S)-1-(4-chlorophenyl)-3-(4-methylphenyl)sulfanylpyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-chlorophenyl)-3-(4-methylphenyl)sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1487266 |
| Molecular Formula | C17H14ClNO2S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | (3S)-1-(4-chlorophenyl)-3-(4-methylphenyl)sulfanylpyrrolidine-2,5-dione |
| SMILES | Cc1ccc(S[C@H]2CC(=O)N(c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C17H14ClNO2S/c1-11-2-8-14(9-3-11)22-15-10-16(20)19(17(15)21)13-6-4-12(18)5-7-13/h2-9,15H,10H2,1H3/t15-/m0/s1 |
| InChIKey | QDJSNDWKIXRDJL-HNNXBMFYSA-N |
| XLogP | 4.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|