C16H13ClN2O2S — CID 98470656
(3R)-3-(3-aminophenyl)sulfanyl-1-(4-chlorophenyl)pyrrolidine-2,5-dione (PubChem CID 98470656) has the molecular formula C16H13ClN2O2S and a molecular weight of 332.81 g/mol. Its IUPAC name is (3R)-3-(3-aminophenyl)sulfanyl-1-(4-chlorophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(3-aminophenyl)sulfanyl-1-(4-chlorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98470656 |
| Molecular Formula | C16H13ClN2O2S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | (3R)-3-(3-aminophenyl)sulfanyl-1-(4-chlorophenyl)pyrrolidine-2,5-dione |
| SMILES | Nc1cccc(S[C@@H]2CC(=O)N(c3ccc(Cl)cc3)C2=O)c1 |
| InChI | InChI=1S/C16H13ClN2O2S/c17-10-4-6-12(7-5-10)19-15(20)9-14(16(19)21)22-13-3-1-2-11(18)8-13/h1-8,14H,9,18H2/t14-/m1/s1 |
| InChIKey | NDBBGWUNQVCWTG-CQSZACIVSA-N |
| XLogP | 3.35 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|