C16H12Cl2N2O2S — CID 99129758
(3R)-3-(3-aminophenyl)sulfanyl-1-(2,5-dichlorophenyl)pyrrolidine-2,5-dione (PubChem CID 99129758) has the molecular formula C16H12Cl2N2O2S and a molecular weight of 367.26 g/mol. Its IUPAC name is (3R)-3-(3-aminophenyl)sulfanyl-1-(2,5-dichlorophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(3-aminophenyl)sulfanyl-1-(2,5-dichlorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 99129758 |
| Molecular Formula | C16H12Cl2N2O2S |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | (3R)-3-(3-aminophenyl)sulfanyl-1-(2,5-dichlorophenyl)pyrrolidine-2,5-dione |
| SMILES | Nc1cccc(S[C@@H]2CC(=O)N(c3cc(Cl)ccc3Cl)C2=O)c1 |
| InChI | InChI=1S/C16H12Cl2N2O2S/c17-9-4-5-12(18)13(6-9)20-15(21)8-14(16(20)22)23-11-3-1-2-10(19)7-11/h1-7,14H,8,19H2/t14-/m1/s1 |
| InChIKey | BOSQVFSGYXLWAQ-CQSZACIVSA-N |
| XLogP | 4.00 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|