C17H16N2O3S — CID 98470653
(3S)-3-(3-aminophenyl)sulfanyl-1-(4-methoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 98470653) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is (3S)-3-(3-aminophenyl)sulfanyl-1-(4-methoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(3-aminophenyl)sulfanyl-1-(4-methoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98470653 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (3S)-3-(3-aminophenyl)sulfanyl-1-(4-methoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C[C@H](Sc3cccc(N)c3)C2=O)cc1 |
| InChI | InChI=1S/C17H16N2O3S/c1-22-13-7-5-12(6-8-13)19-16(20)10-15(17(19)21)23-14-4-2-3-11(18)9-14/h2-9,15H,10,18H2,1H3/t15-/m0/s1 |
| InChIKey | GPDTZRRKKHRKJG-HNNXBMFYSA-N |
| XLogP | 2.70 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|