C31H25N3O6S — CID 18894003
[2-oxo-2-(4-phenoxyanilino)ethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 18894003) has the molecular formula C31H25N3O6S and a molecular weight of 567.62 g/mol. Its IUPAC name is [2-oxo-2-(4-phenoxyanilino)ethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 18894003 |
| Molecular Formula | C31H25N3O6S |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | Nc1cccc(SC2CC(=O)N(c3ccc(C(=O)OCC(=O)Nc4ccc(Oc5ccccc5)cc4)cc3)C2=O)c1 |
| InChI | InChI=1S/C31H25N3O6S/c32-21-5-4-8-26(17-21)41-27-18-29(36)34(30(27)37)23-13-9-20(10-14-23)31(38)39-19-28(35)33-22-11-15-25(16-12-22)40-24-6-2-1-3-7-24/h1-17,27H,18-19,32H2,(H,33,35) |
| InChIKey | MBUIIQDBMPPRBB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|