C25H20IN3O5S — CID 18893997
[2-(4-iodoanilino)-2-oxoethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 18893997) has the molecular formula C25H20IN3O5S and a molecular weight of 601.42 g/mol. Its IUPAC name is [2-(4-iodoanilino)-2-oxoethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(4-iodoanilino)-2-oxoethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 18893997 |
| Molecular Formula | C25H20IN3O5S |
| Molecular Weight | 601.42 g/mol |
| Exact Mass | 601.02 |
| IUPAC Name | [2-(4-iodoanilino)-2-oxoethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | Nc1cccc(SC2CC(=O)N(c3ccc(C(=O)OCC(=O)Nc4ccc(I)cc4)cc3)C2=O)c1 |
| InChI | InChI=1S/C25H20IN3O5S/c26-16-6-8-18(9-7-16)28-22(30)14-34-25(33)15-4-10-19(11-5-15)29-23(31)13-21(24(29)32)35-20-3-1-2-17(27)12-20/h1-12,21H,13-14,27H2,(H,28,30) |
| InChIKey | CRJVWKDCWPCTLM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|