C25H18FNO5S — CID 23095789
[2-(4-fluorophenyl)-2-oxoethyl] 4-(2,5-dioxo-3-phenylsulfanylpyrrolidin-1-yl)benzoate (PubChem CID 23095789) has the molecular formula C25H18FNO5S and a molecular weight of 463.49 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 4-(2,5-dioxo-3-phenylsulfanylpyrrolidin-1-yl)benzoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 4-(2,5-dioxo-3-phenylsulfanylpyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 23095789 |
| Molecular Formula | C25H18FNO5S |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 4-(2,5-dioxo-3-phenylsulfanylpyrrolidin-1-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)CC(Sc3ccccc3)C2=O)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H18FNO5S/c26-18-10-6-16(7-11-18)21(28)15-32-25(31)17-8-12-19(13-9-17)27-23(29)14-22(24(27)30)33-20-4-2-1-3-5-20/h1-13,22H,14-15H2 |
| InChIKey | OSTQRVGQYPYUAC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|