C27H21N3O5S — CID 23099981
phenacyl 4-[3-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23099981) has the molecular formula C27H21N3O5S and a molecular weight of 499.55 g/mol. Its IUPAC name is phenacyl 4-[3-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | phenacyl 4-[3-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23099981 |
| Molecular Formula | C27H21N3O5S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | phenacyl 4-[3-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | Cc1cc(C)c(C#N)c(SC2CC(=O)N(c3ccc(C(=O)OCC(=O)c4ccccc4)cc3)C2=O)n1 |
| InChI | InChI=1S/C27H21N3O5S/c1-16-12-17(2)29-25(21(16)14-28)36-23-13-24(32)30(26(23)33)20-10-8-19(9-11-20)27(34)35-15-22(31)18-6-4-3-5-7-18/h3-12,23H,13,15H2,1-2H3 |
| InChIKey | DMDPTAWIXOYTHN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 117.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|