C30H19N5O6S — CID 21170808
phenacyl 4-[3-[[6-amino-3,5-dicyano-4-(furan-2-yl)-2-pyridinyl]sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21170808) has the molecular formula C30H19N5O6S and a molecular weight of 577.58 g/mol. Its IUPAC name is phenacyl 4-[3-[[6-amino-3,5-dicyano-4-(furan-2-yl)-2-pyridinyl]sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | phenacyl 4-[3-[[6-amino-3,5-dicyano-4-(furan-2-yl)-2-pyridinyl]sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21170808 |
| Molecular Formula | C30H19N5O6S |
| Molecular Weight | 577.58 g/mol |
| Exact Mass | 577.11 |
| IUPAC Name | phenacyl 4-[3-[[6-amino-3,5-dicyano-4-(furan-2-yl)-2-pyridinyl]sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | N#Cc1c(N)nc(SC2CC(=O)N(c3ccc(C(=O)OCC(=O)c4ccccc4)cc3)C2=O)c(C#N)c1-c1ccco1 |
| InChI | InChI=1S/C30H19N5O6S/c31-14-20-26(23-7-4-12-40-23)21(15-32)28(34-27(20)33)42-24-13-25(37)35(29(24)38)19-10-8-18(9-11-19)30(39)41-16-22(36)17-5-2-1-3-6-17/h1-12,24H,13,16H2,(H2,33,34) |
| InChIKey | OSLLMJFBQMSBFK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 180.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|