C37H24ClN3O5S — CID 21172600
[2-(4-chlorophenyl)-2-oxoethyl] 4-[3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21172600) has the molecular formula C37H24ClN3O5S and a molecular weight of 658.14 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 4-[3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 4-[3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21172600 |
| Molecular Formula | C37H24ClN3O5S |
| Molecular Weight | 658.14 g/mol |
| Exact Mass | 657.11 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 4-[3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | N#Cc1c(-c2ccccc2)cc(-c2ccccc2)nc1SC1CC(=O)N(c2ccc(C(=O)OCC(=O)c3ccc(Cl)cc3)cc2)C1=O |
| InChI | InChI=1S/C37H24ClN3O5S/c38-27-15-11-25(12-16-27)32(42)22-46-37(45)26-13-17-28(18-14-26)41-34(43)20-33(36(41)44)47-35-30(21-39)29(23-7-3-1-4-8-23)19-31(40-35)24-9-5-2-6-10-24/h1-19,33H,20,22H2 |
| InChIKey | NXLAIHTZGCPTON-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 117.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.14 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|