C25H18ClNO5S — CID 23097853
phenacyl 4-[3-(4-chlorophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23097853) has the molecular formula C25H18ClNO5S and a molecular weight of 479.94 g/mol. Its IUPAC name is phenacyl 4-[3-(4-chlorophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | phenacyl 4-[3-(4-chlorophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23097853 |
| Molecular Formula | C25H18ClNO5S |
| Molecular Weight | 479.94 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | phenacyl 4-[3-(4-chlorophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)CC(Sc3ccc(Cl)cc3)C2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H18ClNO5S/c26-18-8-12-20(13-9-18)33-22-14-23(29)27(24(22)30)19-10-6-17(7-11-19)25(31)32-15-21(28)16-4-2-1-3-5-16/h1-13,22H,14-15H2 |
| InChIKey | CSYUYKMYHVGTQP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.94 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|