C31H30ClN3O5 — CID 21170123
[2-(4-chlorophenyl)-2-oxoethyl] 4-[3-[(1-benzylpiperidin-4-yl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21170123) has the molecular formula C31H30ClN3O5 and a molecular weight of 560.05 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 4-[3-[(1-benzylpiperidin-4-yl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 4-[3-[(1-benzylpiperidin-4-yl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21170123 |
| Molecular Formula | C31H30ClN3O5 |
| Molecular Weight | 560.05 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 4-[3-[(1-benzylpiperidin-4-yl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)CC(NC3CCN(Cc4ccccc4)CC3)C2=O)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H30ClN3O5/c32-24-10-6-22(7-11-24)28(36)20-40-31(39)23-8-12-26(13-9-23)35-29(37)18-27(30(35)38)33-25-14-16-34(17-15-25)19-21-4-2-1-3-5-21/h1-13,25,27,33H,14-20H2 |
| InChIKey | ONHABJRUQQONSP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.05 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|