C26H28N2O5 — CID 22782224
phenacyl 4-[3-[(4-methylcyclohexyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 22782224) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is phenacyl 4-[3-[(4-methylcyclohexyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | phenacyl 4-[3-[(4-methylcyclohexyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 22782224 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | phenacyl 4-[3-[(4-methylcyclohexyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CC1CCC(NC2CC(=O)N(c3ccc(C(=O)OCC(=O)c4ccccc4)cc3)C2=O)CC1 |
| InChI | InChI=1S/C26H28N2O5/c1-17-7-11-20(12-8-17)27-22-15-24(30)28(25(22)31)21-13-9-19(10-14-21)26(32)33-16-23(29)18-5-3-2-4-6-18/h2-6,9-10,13-14,17,20,22,27H,7-8,11-12,15-16H2,1H3 |
| InChIKey | FMCZFBRQPHCKFV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|