C33H28N2O5 — CID 21168459
[2-oxo-2-(4-phenylphenyl)ethyl] 4-[3-[(4-methylphenyl)methylamino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21168459) has the molecular formula C33H28N2O5 and a molecular weight of 532.60 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylphenyl)ethyl] 4-[3-[(4-methylphenyl)methylamino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-oxo-2-(4-phenylphenyl)ethyl] 4-[3-[(4-methylphenyl)methylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21168459 |
| Molecular Formula | C33H28N2O5 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | [2-oxo-2-(4-phenylphenyl)ethyl] 4-[3-[(4-methylphenyl)methylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | Cc1ccc(CNC2CC(=O)N(c3ccc(C(=O)OCC(=O)c4ccc(-c5ccccc5)cc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C33H28N2O5/c1-22-7-9-23(10-8-22)20-34-29-19-31(37)35(32(29)38)28-17-15-27(16-18-28)33(39)40-21-30(36)26-13-11-25(12-14-26)24-5-3-2-4-6-24/h2-18,29,34H,19-21H2,1H3 |
| InChIKey | XFVGSWLDFOLCOC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|