C27H25N3O7S — CID 21168678
phenacyl 4-[2,5-dioxo-3-[2-(4-sulfamoylphenyl)ethylamino]pyrrolidin-1-yl]benzoate (PubChem CID 21168678) has the molecular formula C27H25N3O7S and a molecular weight of 535.58 g/mol. Its IUPAC name is phenacyl 4-[2,5-dioxo-3-[2-(4-sulfamoylphenyl)ethylamino]pyrrolidin-1-yl]benzoate.
| Compound Name | phenacyl 4-[2,5-dioxo-3-[2-(4-sulfamoylphenyl)ethylamino]pyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21168678 |
| Molecular Formula | C27H25N3O7S |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | phenacyl 4-[2,5-dioxo-3-[2-(4-sulfamoylphenyl)ethylamino]pyrrolidin-1-yl]benzoate |
| SMILES | NS(=O)(=O)c1ccc(CCNC2CC(=O)N(c3ccc(C(=O)OCC(=O)c4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H25N3O7S/c28-38(35,36)22-12-6-18(7-13-22)14-15-29-23-16-25(32)30(26(23)33)21-10-8-20(9-11-21)27(34)37-17-24(31)19-4-2-1-3-5-19/h1-13,23,29H,14-17H2,(H2,28,35,36) |
| InChIKey | ZFXBLNSRMXMCBG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 152.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|