C28H25ClN2O6 — CID 21167497
[2-(4-methoxyphenyl)-2-oxoethyl] 4-[3-[2-(3-chlorophenyl)ethylamino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21167497) has the molecular formula C28H25ClN2O6 and a molecular weight of 520.97 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 4-[3-[2-(3-chlorophenyl)ethylamino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 4-[3-[2-(3-chlorophenyl)ethylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21167497 |
| Molecular Formula | C28H25ClN2O6 |
| Molecular Weight | 520.97 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 4-[3-[2-(3-chlorophenyl)ethylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc(N3C(=O)CC(NCCc4cccc(Cl)c4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C28H25ClN2O6/c1-36-23-11-7-19(8-12-23)25(32)17-37-28(35)20-5-9-22(10-6-20)31-26(33)16-24(27(31)34)30-14-13-18-3-2-4-21(29)15-18/h2-12,15,24,30H,13-14,16-17H2,1H3 |
| InChIKey | HMAQEZYPDZCPFZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.97 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|