C27H30N2O6 — CID 23097666
[2-(3-methoxyphenyl)-2-oxoethyl] 4-[3-(cycloheptylamino)-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23097666) has the molecular formula C27H30N2O6 and a molecular weight of 478.55 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-2-oxoethyl] 4-[3-(cycloheptylamino)-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(3-methoxyphenyl)-2-oxoethyl] 4-[3-(cycloheptylamino)-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23097666 |
| Molecular Formula | C27H30N2O6 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | [2-(3-methoxyphenyl)-2-oxoethyl] 4-[3-(cycloheptylamino)-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COc1cccc(C(=O)COC(=O)c2ccc(N3C(=O)CC(NC4CCCCCC4)C3=O)cc2)c1 |
| InChI | InChI=1S/C27H30N2O6/c1-34-22-10-6-7-19(15-22)24(30)17-35-27(33)18-11-13-21(14-12-18)29-25(31)16-23(26(29)32)28-20-8-4-2-3-5-9-20/h6-7,10-15,20,23,28H,2-5,8-9,16-17H2,1H3 |
| InChIKey | LDRPWRUQCROVRS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|