C26H27FN2O5 — CID 23096155
[2-(4-fluorophenyl)-2-oxoethyl] 4-[3-(cycloheptylamino)-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23096155) has the molecular formula C26H27FN2O5 and a molecular weight of 466.51 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 4-[3-(cycloheptylamino)-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 4-[3-(cycloheptylamino)-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23096155 |
| Molecular Formula | C26H27FN2O5 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 4-[3-(cycloheptylamino)-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)CC(NC3CCCCCC3)C2=O)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H27FN2O5/c27-19-11-7-17(8-12-19)23(30)16-34-26(33)18-9-13-21(14-10-18)29-24(31)15-22(25(29)32)28-20-5-3-1-2-4-6-20/h7-14,20,22,28H,1-6,15-16H2 |
| InChIKey | DTZYJUAITOANRD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|