C27H30N2O7 — CID 23099454
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[3-(cyclohexylamino)-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23099454) has the molecular formula C27H30N2O7 and a molecular weight of 494.54 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[3-(cyclohexylamino)-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[3-(cyclohexylamino)-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23099454 |
| Molecular Formula | C27H30N2O7 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[3-(cyclohexylamino)-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc(N3C(=O)CC(NC4CCCCC4)C3=O)cc2)cc1OC |
| InChI | InChI=1S/C27H30N2O7/c1-34-23-13-10-18(14-24(23)35-2)22(30)16-36-27(33)17-8-11-20(12-9-17)29-25(31)15-21(26(29)32)28-19-6-4-3-5-7-19/h8-14,19,21,28H,3-7,15-16H2,1-2H3 |
| InChIKey | OPDAGTBJVPYPCO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|