C27H24N4O8 — CID 21168448
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[2,5-dioxo-3-[2-(pyridine-3-carbonyl)hydrazinyl]pyrrolidin-1-yl]benzoate (PubChem CID 21168448) has the molecular formula C27H24N4O8 and a molecular weight of 532.51 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[2,5-dioxo-3-[2-(pyridine-3-carbonyl)hydrazinyl]pyrrolidin-1-yl]benzoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[2,5-dioxo-3-[2-(pyridine-3-carbonyl)hydrazinyl]pyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21168448 |
| Molecular Formula | C27H24N4O8 |
| Molecular Weight | 532.51 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[2,5-dioxo-3-[2-(pyridine-3-carbonyl)hydrazinyl]pyrrolidin-1-yl]benzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc(N3C(=O)CC(NNC(=O)c4cccnc4)C3=O)cc2)cc1OC |
| InChI | InChI=1S/C27H24N4O8/c1-37-22-10-7-17(12-23(22)38-2)21(32)15-39-27(36)16-5-8-19(9-6-16)31-24(33)13-20(26(31)35)29-30-25(34)18-4-3-11-28-14-18/h3-12,14,20,29H,13,15H2,1-2H3,(H,30,34) |
| InChIKey | RGSPNALEFVXNSW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 153.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.51 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|