C29H29N3O9S — CID 21171356
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[2,5-dioxo-3-[2-(4-sulfamoylphenyl)ethylamino]pyrrolidin-1-yl]benzoate (PubChem CID 21171356) has the molecular formula C29H29N3O9S and a molecular weight of 595.63 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[2,5-dioxo-3-[2-(4-sulfamoylphenyl)ethylamino]pyrrolidin-1-yl]benzoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[2,5-dioxo-3-[2-(4-sulfamoylphenyl)ethylamino]pyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21171356 |
| Molecular Formula | C29H29N3O9S |
| Molecular Weight | 595.63 g/mol |
| Exact Mass | 595.16 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[2,5-dioxo-3-[2-(4-sulfamoylphenyl)ethylamino]pyrrolidin-1-yl]benzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc(N3C(=O)CC(NCCc4ccc(S(N)(=O)=O)cc4)C3=O)cc2)cc1OC |
| InChI | InChI=1S/C29H29N3O9S/c1-39-25-12-7-20(15-26(25)40-2)24(33)17-41-29(36)19-5-8-21(9-6-19)32-27(34)16-23(28(32)35)31-14-13-18-3-10-22(11-4-18)42(30,37)38/h3-12,15,23,31H,13-14,16-17H2,1-2H3,(H2,30,37,38) |
| InChIKey | YJUVWQYRNCDTGH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 171.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.63 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|