C24H24N2O7 — CID 22782771
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[2,5-dioxo-3-(prop-2-enylamino)pyrrolidin-1-yl]benzoate (PubChem CID 22782771) has the molecular formula C24H24N2O7 and a molecular weight of 452.46 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[2,5-dioxo-3-(prop-2-enylamino)pyrrolidin-1-yl]benzoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[2,5-dioxo-3-(prop-2-enylamino)pyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 22782771 |
| Molecular Formula | C24H24N2O7 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[2,5-dioxo-3-(prop-2-enylamino)pyrrolidin-1-yl]benzoate |
| SMILES | C=CCNC1CC(=O)N(c2ccc(C(=O)OCC(=O)c3ccc(OC)c(OC)c3)cc2)C1=O |
| InChI | InChI=1S/C24H24N2O7/c1-4-11-25-18-13-22(28)26(23(18)29)17-8-5-15(6-9-17)24(30)33-14-19(27)16-7-10-20(31-2)21(12-16)32-3/h4-10,12,18,25H,1,11,13-14H2,2-3H3 |
| InChIKey | KYBMFSLNDPHWTO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|