C21H22O7 — CID 18123440
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 3-methoxy-4-prop-2-enoxybenzoate (PubChem CID 18123440) has the molecular formula C21H22O7 and a molecular weight of 386.40 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 3-methoxy-4-prop-2-enoxybenzoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 3-methoxy-4-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 18123440 |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 3-methoxy-4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)OCC(=O)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C21H22O7/c1-5-10-27-18-9-7-15(12-20(18)26-4)21(23)28-13-16(22)14-6-8-17(24-2)19(11-14)25-3/h5-9,11-12H,1,10,13H2,2-4H3 |
| InChIKey | NPAOJHPFSOIPQP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|