C23H27NO7 — CID 33258152
[2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 3-methoxy-4-prop-2-enoxybenzoate (PubChem CID 33258152) has the molecular formula C23H27NO7 and a molecular weight of 429.47 g/mol. Its IUPAC name is [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 3-methoxy-4-prop-2-enoxybenzoate.
| Compound Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 3-methoxy-4-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 33258152 |
| Molecular Formula | C23H27NO7 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 3-methoxy-4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)OCC(=O)NCCOc2ccc(OCC)cc2)cc1OC |
| InChI | InChI=1S/C23H27NO7/c1-4-13-30-20-11-6-17(15-21(20)27-3)23(26)31-16-22(25)24-12-14-29-19-9-7-18(8-10-19)28-5-2/h4,6-11,15H,1,5,12-14,16H2,2-3H3,(H,24,25) |
| InChIKey | FVQZXBZCDBWBHS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|