C20H23NO7 — CID 2501283
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate (PubChem CID 2501283) has the molecular formula C20H23NO7 and a molecular weight of 389.40 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 2501283 |
| Molecular Formula | C20H23NO7 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)Nc2cc(OC)ccc2OC)cc1OC |
| InChI | InChI=1S/C20H23NO7/c1-5-27-17-8-6-13(10-18(17)26-4)20(23)28-12-19(22)21-15-11-14(24-2)7-9-16(15)25-3/h6-11H,5,12H2,1-4H3,(H,21,22) |
| InChIKey | SFXRADSETYHHNT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |