C18H18N2O6 — CID 30799809
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 4-carbamoylbenzoate (PubChem CID 30799809) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 4-carbamoylbenzoate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 4-carbamoylbenzoate |
|---|---|
| PubChem CID | 30799809 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 4-carbamoylbenzoate |
| SMILES | COc1ccc(OC)c(NC(=O)COC(=O)c2ccc(C(N)=O)cc2)c1 |
| InChI | InChI=1S/C18H18N2O6/c1-24-13-7-8-15(25-2)14(9-13)20-16(21)10-26-18(23)12-5-3-11(4-6-12)17(19)22/h3-9H,10H2,1-2H3,(H2,19,22)(H,20,21) |
| InChIKey | VSHRUGBMMDSRKO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |