C17H15Cl2NO5 — CID 2489330
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 3,5-dichlorobenzoate (PubChem CID 2489330) has the molecular formula C17H15Cl2NO5 and a molecular weight of 384.22 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 3,5-dichlorobenzoate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 2489330 |
| Molecular Formula | C17H15Cl2NO5 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 3,5-dichlorobenzoate |
| SMILES | COc1ccc(OC)c(NC(=O)COC(=O)c2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C17H15Cl2NO5/c1-23-13-3-4-15(24-2)14(8-13)20-16(21)9-25-17(22)10-5-11(18)7-12(19)6-10/h3-8H,9H2,1-2H3,(H,20,21) |
| InChIKey | KYAHRANADBOUSE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |