C15H16N2O5 — CID 8544216
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 1H-pyrrole-2-carboxylate (PubChem CID 8544216) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1H-pyrrole-2-carboxylate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 8544216 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1H-pyrrole-2-carboxylate |
| SMILES | COc1ccc(OC)c(NC(=O)COC(=O)c2ccc[nH]2)c1 |
| InChI | InChI=1S/C15H16N2O5/c1-20-10-5-6-13(21-2)12(8-10)17-14(18)9-22-15(19)11-4-3-7-16-11/h3-8,16H,9H2,1-2H3,(H,17,18) |
| InChIKey | GJAPDKHKGULDGQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |